CAS 1258650-40-6 is the registry number for 2-(4-Chlorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(4-chlorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (CAS 1258650-40-6) is a chemical compound with the molecular formula C13H10ClNOS and a molecular weight of 263.74 g/mol. IUPAC name: 2-(4-chlorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one. InChIKey: XXCCTQYLMPIBBY-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNOS |
|---|---|
| Molecular weight | 263.74 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| InChIKey | XXCCTQYLMPIBBY-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)SC(=N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)