Products 175135-78-1

CAS 175135-78-1 is the registry number for 2-[(4-Methylphenyl)thio]pyridine-3-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-methylphenyl)sulfanylpyridine-3-carbonyl chloride (CAS 175135-78-1) is a chemical compound with the molecular formula C13H10ClNOS and a molecular weight of 263.74 g/mol. IUPAC name: 2-(4-methylphenyl)sulfanylpyridine-3-carbonyl chloride. InChIKey: PSCMJHVAZWDLBP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNOS
Molecular weight263.74 g/mol
IUPAC name2-(4-methylphenyl)sulfanylpyridine-3-carbonyl chloride
InChIKeyPSCMJHVAZWDLBP-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)SC2=C(C=CC=N2)C(=O)Cl

Computed by PubChem (NCBI)