CAS 175135-78-1 is the registry number for 2-[(4-Methylphenyl)thio]pyridine-3-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-(4-methylphenyl)sulfanylpyridine-3-carbonyl chloride (CAS 175135-78-1) is a chemical compound with the molecular formula C13H10ClNOS and a molecular weight of 263.74 g/mol. IUPAC name: 2-(4-methylphenyl)sulfanylpyridine-3-carbonyl chloride. InChIKey: PSCMJHVAZWDLBP-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNOS |
|---|---|
| Molecular weight | 263.74 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfanylpyridine-3-carbonyl chloride |
| InChIKey | PSCMJHVAZWDLBP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC2=C(C=CC=N2)C(=O)Cl |
Computed by PubChem (NCBI)