CAS 125867-31-4 appears in our catalog under these names: 4-Pivalamidonicotinic acid, 95+%, 4-[(2,2-Dimethylpropanoyl)amino]nicotinic acid, 95%, 4-(2,2,2-Trimethylacetamino)pyridine-3-carboxylic acid. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 100mg, 10g, 1g, 250mg.
4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid (CAS 125867-31-4) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: 4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid. InChIKey: UHGXHDOYHCDENE-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 4-(2,2-dimethylpropanoylamino)pyridine-3-carboxylic acid |
| InChIKey | UHGXHDOYHCDENE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=NC=C1)C(=O)O |
Computed by PubChem (NCBI)