Products 1259056-34-2
CAS 1259056-34-2 appears in our catalog under these names: 4-Cyano-azepane-1-carboxylic acid tert-butyl ester, 95%, N-BOC-4-Cyanoazepane, tert-Butyl 4-cyanoazepane-1-carboxylate 97%, tert-butyl 4-cyanoazepane-1-carboxylate, 97%, 97%, N-BOC-4-CYANOAZEPANE, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 5g, 10g, 25g, 100g, 100mg.
Tert-butyl 4-cyanoazepane-1-carboxylate (CAS 1259056-34-2) is a chemical compound with the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. IUPAC name: tert-butyl 4-cyanoazepane-1-carboxylate. InChIKey: GWIFZKJNRMQRJU-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | tert-butyl 4-cyanoazepane-1-carboxylate |
| InChIKey | GWIFZKJNRMQRJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CC1)C#N |
Computed by PubChem (NCBI)