CAS 1259060-82-6 appears in our catalog under these names: 3-Indolizinecarboxylic Acid, Indolizine-3-carboxylic acid, 97%, Indolizine-3-carboxylic acid 95%, Indolizine-3-carboxylic acid, 95%, 95%, Indolizine-3-carboxylic acid, 95%. Offered by: TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 500mg, 5g, 50mg, 100mg, 250mg, 1g.
Indolizine-3-carboxylic acid (CAS 1259060-82-6) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: indolizine-3-carboxylic acid. InChIKey: LKLKDFKQBJWONS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | indolizine-3-carboxylic acid |
| InChIKey | LKLKDFKQBJWONS-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC=C(N2C=C1)C(=O)O |
Computed by PubChem (NCBI)