CAS 1259223-98-7 is the registry number for Isoquinoline, 1,3-dichloro-5-fluoro-, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
1,3-dichloro-5-fluoroisoquinoline (CAS 1259223-98-7) is a chemical compound with the molecular formula C9H4Cl2FN and a molecular weight of 216.04 g/mol. IUPAC name: 1,3-dichloro-5-fluoroisoquinoline. InChIKey: JAJZIXXLBFCSAX-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2FN |
|---|---|
| Molecular weight | 216.04 g/mol |
| IUPAC name | 1,3-dichloro-5-fluoroisoquinoline |
| InChIKey | JAJZIXXLBFCSAX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(N=C(C=C2C(=C1)F)Cl)Cl |
Computed by PubChem (NCBI)