CAS 1259438-77-1 appears in our catalog under these names: 2,4-Dichloro-6-fluoro-3-methylquinoline, 95%, 2,4-Dichloro-6-fluoro-3-methylquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2,4-dichloro-6-fluoro-3-methylquinoline (CAS 1259438-77-1) is a chemical compound with the molecular formula C10H6Cl2FN and a molecular weight of 230.06 g/mol. IUPAC name: 2,4-dichloro-6-fluoro-3-methylquinoline. InChIKey: TZNYZKHLTMTHBU-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2FN |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2,4-dichloro-6-fluoro-3-methylquinoline |
| InChIKey | TZNYZKHLTMTHBU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=CC(=C2)F)N=C1Cl)Cl |
Computed by PubChem (NCBI)