CAS 1697517-56-8 is the registry number for 2,5-Dichloro-7-fluoro-3-methylquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dichloro-7-fluoro-3-methylquinoline (CAS 1697517-56-8) is a chemical compound with the molecular formula C10H6Cl2FN and a molecular weight of 230.06 g/mol. IUPAC name: 2,5-dichloro-7-fluoro-3-methylquinoline. InChIKey: RQFXKIKIBHXCOI-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2FN |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2,5-dichloro-7-fluoro-3-methylquinoline |
| InChIKey | RQFXKIKIBHXCOI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(C=C2Cl)F)N=C1Cl |
Computed by PubChem (NCBI)