CAS 1259774-63-4 is the registry number for 1H-Inden-1-amine, 4-bromo-2,3-dihydro-6-methyl-, (1R)-, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine (CAS 1259774-63-4) is a chemical compound with the molecular formula C10H12BrN and a molecular weight of 226.11 g/mol. IUPAC name: (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine. InChIKey: ZTVOBQOGJGGIJZ-SNVBAGLBSA-N.
| Molecular formula | C10H12BrN |
|---|---|
| Molecular weight | 226.11 g/mol |
| IUPAC name | (1R)-4-bromo-6-methyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | ZTVOBQOGJGGIJZ-SNVBAGLBSA-N |
| SMILES | CC1=CC2=C(CC[C@H]2N)C(=C1)Br |
Computed by PubChem (NCBI)