CAS 1259783-15-7 is the registry number for (R)-1-(2,6-Dibromophenyl)ethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2,6-dibromophenyl)ethanamine (CAS 1259783-15-7) is a chemical compound with the molecular formula C8H9Br2N and a molecular weight of 278.97 g/mol. IUPAC name: (1R)-1-(2,6-dibromophenyl)ethanamine. InChIKey: AJUWRFILDRLHFZ-RXMQYKEDSA-N.
| Molecular formula | C8H9Br2N |
|---|---|
| Molecular weight | 278.97 g/mol |
| IUPAC name | (1R)-1-(2,6-dibromophenyl)ethanamine |
| InChIKey | AJUWRFILDRLHFZ-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C=CC=C1Br)Br)N |
Computed by PubChem (NCBI)