Products 81100-30-3

CAS 81100-30-3 is the registry number for 2,4-Dibromo-6-ethylaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

2,4-dibromo-6-ethylaniline (CAS 81100-30-3) is a chemical compound with the molecular formula C8H9Br2N and a molecular weight of 278.97 g/mol. IUPAC name: 2,4-dibromo-6-ethylaniline. InChIKey: YZYOBGJRULPHQC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9Br2N
Molecular weight278.97 g/mol
IUPAC name2,4-dibromo-6-ethylaniline
InChIKeyYZYOBGJRULPHQC-UHFFFAOYSA-N
SMILESCCC1=C(C(=CC(=C1)Br)Br)N

Computed by PubChem (NCBI)