CAS 1260007-95-1 appears in our catalog under these names: 5-Bromo-6-fluoro-2,3-dihydro-1-benzofuran-3-one, 95%, 5-Bromo-6-fluoro-2,3-dihydro-1-benzofuran-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
5-bromo-6-fluoro-1-benzofuran-3-one (CAS 1260007-95-1) is a chemical compound with the molecular formula C8H4BrFO2 and a molecular weight of 231.02 g/mol. IUPAC name: 5-bromo-6-fluoro-1-benzofuran-3-one. InChIKey: DMQWPYUQSULBST-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFO2 |
|---|---|
| Molecular weight | 231.02 g/mol |
| IUPAC name | 5-bromo-6-fluoro-1-benzofuran-3-one |
| InChIKey | DMQWPYUQSULBST-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC(=C(C=C2O1)F)Br |
Computed by PubChem (NCBI)