CAS 1823361-16-5 is the registry number for 6–Bromo–7–fluoroisobenzofuran–1(3H)–one. Offered by: GLPBio. Available pack sizes: 100mg.
6-bromo-7-fluoro-3H-2-benzofuran-1-one (CAS 1823361-16-5) is a chemical compound with the molecular formula C8H4BrFO2 and a molecular weight of 231.02 g/mol. IUPAC name: 6-bromo-7-fluoro-3H-2-benzofuran-1-one. InChIKey: VVSWDLKBMDUXNC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFO2 |
|---|---|
| Molecular weight | 231.02 g/mol |
| IUPAC name | 6-bromo-7-fluoro-3H-2-benzofuran-1-one |
| InChIKey | VVSWDLKBMDUXNC-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=C(C=C2)Br)F)C(=O)O1 |
Computed by PubChem (NCBI)