CAS 1260220-43-6 appears in our catalog under these names: (S)-tert-Butyl 2-(4-aminophenyl)morpholine-4-carboxylate, 95+%, (S)-tert-Butyl 2-(4-aminophenyl)morpholine-4-carboxylate, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g.
Tert-butyl (2S)-2-(4-aminophenyl)morpholine-4-carboxylate (CAS 1260220-43-6) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: tert-butyl (2S)-2-(4-aminophenyl)morpholine-4-carboxylate. InChIKey: RYLFTAZSKDUPAA-CYBMUJFWSA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | tert-butyl (2S)-2-(4-aminophenyl)morpholine-4-carboxylate |
| InChIKey | RYLFTAZSKDUPAA-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)