Products 1381929-59-4

CAS 1381929-59-4 is the registry number for N-Ethyl L-Z-Valinamide, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-1-(ethylamino)-3-methyl-1-oxobutan-2-yl]carbamate (CAS 1381929-59-4) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: benzyl N-[(2S)-1-(ethylamino)-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: OTDSKJYLBAFHHU-ZDUSSCGKSA-N.

Identity
Molecular formulaC15H22N2O3
Molecular weight278.35 g/mol
IUPAC namebenzyl N-[(2S)-1-(ethylamino)-3-methyl-1-oxobutan-2-yl]carbamate
InChIKeyOTDSKJYLBAFHHU-ZDUSSCGKSA-N
SMILESCCNC(=O)[C@H](C(C)C)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)