CAS 1260382-00-0 is the registry number for 6-Chloro-5-methoxy-1H-pyrrolo[2,3-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
6-chloro-5-methoxy-1H-pyrrolo[2,3-b]pyridine (CAS 1260382-00-0) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 6-chloro-5-methoxy-1H-pyrrolo[2,3-b]pyridine. InChIKey: FZXUMNQHGLZWIR-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 6-chloro-5-methoxy-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | FZXUMNQHGLZWIR-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C2C(=C1)C=CN2)Cl |
Computed by PubChem (NCBI)