Products 1260382-00-0

CAS 1260382-00-0 is the registry number for 6-Chloro-5-methoxy-1H-pyrrolo[2,3-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

6-chloro-5-methoxy-1H-pyrrolo[2,3-b]pyridine (CAS 1260382-00-0) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 6-chloro-5-methoxy-1H-pyrrolo[2,3-b]pyridine. InChIKey: FZXUMNQHGLZWIR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClN2O
Molecular weight182.61 g/mol
IUPAC name6-chloro-5-methoxy-1H-pyrrolo[2,3-b]pyridine
InChIKeyFZXUMNQHGLZWIR-UHFFFAOYSA-N
SMILESCOC1=C(N=C2C(=C1)C=CN2)Cl

Computed by PubChem (NCBI)