CAS 1260389-32-9 is the registry number for 5-Fluoro-4'-methoxybiphenyl-2-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-fluoro-2-(4-methoxyphenyl)benzonitrile (CAS 1260389-32-9) is a chemical compound with the molecular formula C14H10FNO and a molecular weight of 227.23 g/mol. IUPAC name: 4-fluoro-2-(4-methoxyphenyl)benzonitrile. InChIKey: VYZOICPJTKGVSM-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO |
|---|---|
| Molecular weight | 227.23 g/mol |
| IUPAC name | 4-fluoro-2-(4-methoxyphenyl)benzonitrile |
| InChIKey | VYZOICPJTKGVSM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C=CC(=C2)F)C#N |
Computed by PubChem (NCBI)