CAS 94088-45-6 appears in our catalog under these names: 2–Fluoro–6–phenylmethoxybenzonitrile, 2-Benzyloxy-6-fluorobenzonitrile, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg, 5g, 25g.
2-fluoro-6-phenylmethoxybenzonitrile (CAS 94088-45-6) is a chemical compound with the molecular formula C14H10FNO and a molecular weight of 227.23 g/mol. IUPAC name: 2-fluoro-6-phenylmethoxybenzonitrile. InChIKey: ITKHCBLEEGSDOF-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO |
|---|---|
| Molecular weight | 227.23 g/mol |
| IUPAC name | 2-fluoro-6-phenylmethoxybenzonitrile |
| InChIKey | ITKHCBLEEGSDOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=CC=C2)F)C#N |
Computed by PubChem (NCBI)