CAS 1260525-53-8 appears in our catalog under these names: Levonorgestrel EP Impurity A, Levonorgestrel impurity A, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10mg, 25mg, 100mg.
(9R,10R,13S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,9,10,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-one (CAS 1260525-53-8) is a chemical compound with the molecular formula C21H26O2 and a molecular weight of 310.4 g/mol. IUPAC name: (9R,10R,13S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,9,10,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-one. InChIKey: PIGNQOCLJHWTGZ-JWWGGVBKSA-N.
| Molecular formula | C21H26O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | (9R,10R,13S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,9,10,11,12,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | PIGNQOCLJHWTGZ-JWWGGVBKSA-N |
| SMILES | CC[C@]12CC[C@@H]3[C@H]4CCC(=O)C=C4CCC3=C1CC[C@]2(C#C)O |
Computed by PubChem (NCBI)