CAS 1260589-74-9 is the registry number for (3R)-3-Cyclopropyl-3-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3R)-3-cyclopropyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1260589-74-9) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (3R)-3-cyclopropyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: KQKYKWUUVQMRPX-LJQANCHMSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (3R)-3-cyclopropyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | KQKYKWUUVQMRPX-LJQANCHMSA-N |
| SMILES | C1CC1[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)