CAS 1260591-46-5 appears in our catalog under these names: Fmoc-2-trifluoromethyl-L-homophenylalanine, 95%, Fmoc-2-trifluoromethyl-L-homophenylalanine, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[2-(trifluoromethyl)phenyl]butanoic acid (CAS 1260591-46-5) is a chemical compound with the molecular formula C26H22F3NO4 and a molecular weight of 469.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[2-(trifluoromethyl)phenyl]butanoic acid. InChIKey: OQCKZFPPEYXSHT-QHCPKHFHSA-N.
| Molecular formula | C26H22F3NO4 |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[2-(trifluoromethyl)phenyl]butanoic acid |
| InChIKey | OQCKZFPPEYXSHT-QHCPKHFHSA-N |
| SMILES | C1=CC=C(C(=C1)CC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(F)(F)F |
Computed by PubChem (NCBI)