CAS 1260604-58-7 is the registry number for Fmoc-4-trifluoromethyl-D-homophenylalanine, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-(trifluoromethyl)phenyl]butanoic acid (CAS 1260604-58-7) is a chemical compound with the molecular formula C26H22F3NO4 and a molecular weight of 469.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-(trifluoromethyl)phenyl]butanoic acid. InChIKey: WSAZRJANUJZPLG-HSZRJFAPSA-N.
| Molecular formula | C26H22F3NO4 |
|---|---|
| Molecular weight | 469.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[4-(trifluoromethyl)phenyl]butanoic acid |
| InChIKey | WSAZRJANUJZPLG-HSZRJFAPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC4=CC=C(C=C4)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)