CAS 1260592-32-2 appears in our catalog under these names: Fmoc-L-Phe(3-OCF3)-OH, Fmoc-L-Phe(3-OCF3)-OH 95%. Offered by: Iris Biotech, Ambeed. Available pack sizes: 1g, 50mg, 250mg, 100mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethoxy)phenyl]propanoic acid (CAS 1260592-32-2) is a chemical compound with the molecular formula C25H20F3NO5 and a molecular weight of 471.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethoxy)phenyl]propanoic acid. InChIKey: JAUYXFMCEZXVPZ-QFIPXVFZSA-N.
| Molecular formula | C25H20F3NO5 |
|---|---|
| Molecular weight | 471.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethoxy)phenyl]propanoic acid |
| InChIKey | JAUYXFMCEZXVPZ-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC=C4)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)