CAS 1260592-66-2 is the registry number for Boc-4-trifluoromethyl-L-homophenylalanine, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(trifluoromethyl)phenyl]butanoic acid (CAS 1260592-66-2) is a chemical compound with the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(trifluoromethyl)phenyl]butanoic acid. InChIKey: UIQDQODDDQSNKX-LBPRGKRZSA-N.
| Molecular formula | C16H20F3NO4 |
|---|---|
| Molecular weight | 347.33 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[4-(trifluoromethyl)phenyl]butanoic acid |
| InChIKey | UIQDQODDDQSNKX-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC1=CC=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)