CAS 881995-73-9 appears in our catalog under these names: Sitagliptin Impurity 45, Methyl (R)-b-(Boc-amino)-2,4,5-trifluorobenzenebutanoate, 95%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 5g.
Methyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate (CAS 881995-73-9) is a chemical compound with the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. IUPAC name: methyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate. InChIKey: INQCBWDBMIXHDN-SNVBAGLBSA-N.
| Molecular formula | C16H20F3NO4 |
|---|---|
| Molecular weight | 347.33 g/mol |
| IUPAC name | methyl (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoate |
| InChIKey | INQCBWDBMIXHDN-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=C(C=C1F)F)F)CC(=O)OC |
Computed by PubChem (NCBI)