CAS 1260608-07-8 appears in our catalog under these names: Fmoc–3,4–difluoro–L–homophenylalanine, Fmoc-3,4-difluoro-L-homophenylalanine, 95%, 95%, Fmoc-HoPhe(3,4-DiF)-OH, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 25mg, 250mg, 1g.
(2S)-4-(3,4-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1260608-07-8) is a chemical compound with the molecular formula C25H21F2NO4 and a molecular weight of 437.4 g/mol. IUPAC name: (2S)-4-(3,4-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: SVHBVIFVZSOURL-QHCPKHFHSA-N.
| Molecular formula | C25H21F2NO4 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (2S)-4-(3,4-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | SVHBVIFVZSOURL-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC4=CC(=C(C=C4)F)F)C(=O)O |
Computed by PubChem (NCBI)