CAS 1260609-44-6 appears in our catalog under these names: Fmoc–2,3–difluoro–L–homophenylalanine, Fmoc-HoPhe(2,3-DiF)-OH 95%, Fmoc-2,3-difluoro-L-homophenylalanine, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(2S)-4-(2,3-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1260609-44-6) is a chemical compound with the molecular formula C25H21F2NO4 and a molecular weight of 437.4 g/mol. IUPAC name: (2S)-4-(2,3-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LKQNPTJSKHQTCZ-QFIPXVFZSA-N.
| Molecular formula | C25H21F2NO4 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (2S)-4-(2,3-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LKQNPTJSKHQTCZ-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC4=C(C(=CC=C4)F)F)C(=O)O |
Computed by PubChem (NCBI)