CAS 1260609-57-1 appears in our catalog under these names: (R)-a-(Fmoc-amino)-3,5-difluorobenzenebutanoic acid, 95%, (R)-a-(Fmoc-amino)-3,5-difluorobenzenebutanoic acid, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g.
(2R)-4-(3,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1260609-57-1) is a chemical compound with the molecular formula C25H21F2NO4 and a molecular weight of 437.4 g/mol. IUPAC name: (2R)-4-(3,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: JSQRFDWFUHWLOE-HSZRJFAPSA-N.
| Molecular formula | C25H21F2NO4 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | (2R)-4-(3,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | JSQRFDWFUHWLOE-HSZRJFAPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC4=CC(=CC(=C4)F)F)C(=O)O |
Computed by PubChem (NCBI)