Products 1260615-64-2
CAS 1260615-64-2 is the registry number for (R)-3-([1,1'-Biphenyl]-3-yl)-2-(((tert-butoxycarbonyl)amino)methyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-(3-phenylphenyl)propanoic acid (CAS 1260615-64-2) is a chemical compound with the molecular formula C21H25NO4 and a molecular weight of 355.4 g/mol. IUPAC name: (2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-(3-phenylphenyl)propanoic acid. InChIKey: XOBPRXNGISDXRY-GOSISDBHSA-N.
| Molecular formula | C21H25NO4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2R)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-(3-phenylphenyl)propanoic acid |
| InChIKey | XOBPRXNGISDXRY-GOSISDBHSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CC1=CC(=CC=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)