Products 1260615-97-1

CAS 1260615-97-1 is the registry number for Fmoc-D-Abu(pyridin-3-yl)-OH, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-3-ylbutanoic acid (CAS 1260615-97-1) is a chemical compound with the molecular formula C24H22N2O4 and a molecular weight of 402.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-3-ylbutanoic acid. InChIKey: QUWMTZAPSYLMSZ-JOCHJYFZSA-N.

Identity
Molecular formulaC24H22N2O4
Molecular weight402.4 g/mol
IUPAC name(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridin-3-ylbutanoic acid
InChIKeyQUWMTZAPSYLMSZ-JOCHJYFZSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC4=CN=CC=C4)C(=O)O

Computed by PubChem (NCBI)