Products 1260618-67-4
CAS 1260618-67-4 appears in our catalog under these names: (S)-3-((tert-Butoxycarbonyl)amino)-2-(naphthalen-2-ylmethyl)propanoic acid, 98%, (S)-3-((tert-Butoxycarbonyl)amino)-2-(naphthalen-2-ylmethyl)propanoic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 50mg, 100mg, 250mg.
(2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-naphthalen-2-ylpropanoic acid (CAS 1260618-67-4) is a chemical compound with the molecular formula C19H23NO4 and a molecular weight of 329.4 g/mol. IUPAC name: (2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-naphthalen-2-ylpropanoic acid. InChIKey: BFBAJLQTONSFEB-INIZCTEOSA-N.
| Molecular formula | C19H23NO4 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (2S)-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-3-naphthalen-2-ylpropanoic acid |
| InChIKey | BFBAJLQTONSFEB-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](CC1=CC2=CC=CC=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)