CAS 1260640-43-4 appears in our catalog under these names: (R,S)-Fmoc-2-amino-4,4-difluoro-butyric acid, 95%, (R,S)-Fmoc-2-amino-4,4-difluoro-butyric acid, 97%, Fmoc-DfAbu-OH (rac), 2-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)-4,4-difluorobutanoic acid. Offered by: Combi-blocks, AmBeed, Iris Biotech, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 5g, 0,5g, 50mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-difluorobutanoic acid (CAS 1260640-43-4) is a chemical compound with the molecular formula C19H17F2NO4 and a molecular weight of 361.3 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-difluorobutanoic acid. InChIKey: AYIZPDXXYIFMQC-UHFFFAOYSA-N.
| Molecular formula | C19H17F2NO4 |
|---|---|
| Molecular weight | 361.3 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-difluorobutanoic acid |
| InChIKey | AYIZPDXXYIFMQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(F)F)C(=O)O |
Computed by PubChem (NCBI)