CAS 2349627-73-0 is the registry number for Fmoc-L-2-amino-3,3-difluorobutyric acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-difluorobutanoic acid (CAS 2349627-73-0) is a chemical compound with the molecular formula C19H17F2NO4 and a molecular weight of 361.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-difluorobutanoic acid. InChIKey: MBQGOAXGLIUBDQ-INIZCTEOSA-N.
| Molecular formula | C19H17F2NO4 |
|---|---|
| Molecular weight | 361.3 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-difluorobutanoic acid |
| InChIKey | MBQGOAXGLIUBDQ-INIZCTEOSA-N |
| SMILES | CC([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)(F)F |
Computed by PubChem (NCBI)