Products 2349627-73-0

CAS 2349627-73-0 is the registry number for Fmoc-L-2-amino-3,3-difluorobutyric acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-difluorobutanoic acid (CAS 2349627-73-0) is a chemical compound with the molecular formula C19H17F2NO4 and a molecular weight of 361.3 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-difluorobutanoic acid. InChIKey: MBQGOAXGLIUBDQ-INIZCTEOSA-N.

Identity
Molecular formulaC19H17F2NO4
Molecular weight361.3 g/mol
IUPAC name(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-difluorobutanoic acid
InChIKeyMBQGOAXGLIUBDQ-INIZCTEOSA-N
SMILESCC([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)(F)F

Computed by PubChem (NCBI)