Products 1260664-49-0
CAS 1260664-49-0 is the registry number for Ethyl5-bromo-2-((tert-butoxycarbonyl)amino)thiophene-3-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg.
Ethyl 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate (CAS 1260664-49-0) is a chemical compound with the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. IUPAC name: ethyl 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate. InChIKey: YDJQTTORMFUEEL-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO4S |
|---|---|
| Molecular weight | 350.23 g/mol |
| IUPAC name | ethyl 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylate |
| InChIKey | YDJQTTORMFUEEL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)