Products 2489440-86-8
CAS 2489440-86-8 is the registry number for 2-(4-Bromo-3-(N-(tert-butyl)sulfamoyl)phenyl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-bromo-3-(tert-butylsulfamoyl)phenyl]acetic acid (CAS 2489440-86-8) is a chemical compound with the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. IUPAC name: 2-[4-bromo-3-(tert-butylsulfamoyl)phenyl]acetic acid. InChIKey: VWYFPGDWLCLEQW-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO4S |
|---|---|
| Molecular weight | 350.23 g/mol |
| IUPAC name | 2-[4-bromo-3-(tert-butylsulfamoyl)phenyl]acetic acid |
| InChIKey | VWYFPGDWLCLEQW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=C(C=CC(=C1)CC(=O)O)Br |
Computed by PubChem (NCBI)