CAS 1260667-27-3 is the registry number for Ethyl 5,6-diaminopicolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5,6-diaminopyridine-2-carboxylate (CAS 1260667-27-3) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: ethyl 5,6-diaminopyridine-2-carboxylate. InChIKey: MWVRPLBRWLNLDM-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | ethyl 5,6-diaminopyridine-2-carboxylate |
| InChIKey | MWVRPLBRWLNLDM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(C=C1)N)N |
Computed by PubChem (NCBI)