Products 1260667-27-3

CAS 1260667-27-3 is the registry number for Ethyl 5,6-diaminopicolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 5,6-diaminopyridine-2-carboxylate (CAS 1260667-27-3) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: ethyl 5,6-diaminopyridine-2-carboxylate. InChIKey: MWVRPLBRWLNLDM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11N3O2
Molecular weight181.19 g/mol
IUPAC nameethyl 5,6-diaminopyridine-2-carboxylate
InChIKeyMWVRPLBRWLNLDM-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC(=C(C=C1)N)N

Computed by PubChem (NCBI)