CAS 1260679-52-4 appears in our catalog under these names: 2-Amino-1-(4-bromo-3-fluorophenyl)ethanone hydrochloride, 95%, 2–Amino–1–(4–bromo–3–fluorophenyl)ethanone hydrochloride, 2-Amino-1-(4-bromo-3-fluorophenyl)ethanone hydrochloride, 98%, 98%, 2-Amino-1-(4-bromo-3-fluorophenyl)ethanone hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-amino-1-(4-bromo-3-fluorophenyl)ethanone;hydrochloride (CAS 1260679-52-4) is a chemical compound with the molecular formula C8H8BrClFNO and a molecular weight of 268.51 g/mol. IUPAC name: 2-amino-1-(4-bromo-3-fluorophenyl)ethanone;hydrochloride. InChIKey: SDDJUSCOXLXSAB-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClFNO |
|---|---|
| Molecular weight | 268.51 g/mol |
| IUPAC name | 2-amino-1-(4-bromo-3-fluorophenyl)ethanone;hydrochloride |
| InChIKey | SDDJUSCOXLXSAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CN)F)Br.Cl |
Computed by PubChem (NCBI)