Products 1820619-11-1
CAS 1820619-11-1 is the registry number for 6-Bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride (CAS 1820619-11-1) is a chemical compound with the molecular formula C8H8BrClFNO and a molecular weight of 268.51 g/mol. IUPAC name: 6-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride. InChIKey: DJAFHNKPWKGLIY-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClFNO |
|---|---|
| Molecular weight | 268.51 g/mol |
| IUPAC name | 6-bromo-7-fluoro-3,4-dihydro-2H-1,4-benzoxazine;hydrochloride |
| InChIKey | DJAFHNKPWKGLIY-UHFFFAOYSA-N |
| SMILES | C1COC2=CC(=C(C=C2N1)Br)F.Cl |
Computed by PubChem (NCBI)