CAS 126070-22-2 appears in our catalog under these names: 5,6,7,8-Tetrahydro-3,5,5,8,8-pentamethyl-2-naphthoic Acid, 5,6,7,8-Tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenecarboxylic acid, 95%, 95%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg.
3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carboxylic acid (CAS 126070-22-2) is a chemical compound with the molecular formula C16H22O2 and a molecular weight of 246.34 g/mol. IUPAC name: 3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carboxylic acid. InChIKey: NDLUWYQGXPZYQN-UHFFFAOYSA-N.
| Molecular formula | C16H22O2 |
|---|---|
| Molecular weight | 246.34 g/mol |
| IUPAC name | 3,5,5,8,8-pentamethyl-6,7-dihydronaphthalene-2-carboxylic acid |
| InChIKey | NDLUWYQGXPZYQN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=O)O)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)