Products 923249-62-1

CAS 923249-62-1 is the registry number for 1-(4-tert-Butylphenyl)cyclopentane-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

1-(4-tert-butylphenyl)cyclopentane-1-carboxylic acid (CAS 923249-62-1) is a chemical compound with the molecular formula C16H22O2 and a molecular weight of 246.34 g/mol. IUPAC name: 1-(4-tert-butylphenyl)cyclopentane-1-carboxylic acid. InChIKey: NJZGYIVRHNPBFP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22O2
Molecular weight246.34 g/mol
IUPAC name1-(4-tert-butylphenyl)cyclopentane-1-carboxylic acid
InChIKeyNJZGYIVRHNPBFP-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)C2(CCCC2)C(=O)O

Computed by PubChem (NCBI)