CAS 1260761-31-6 appears in our catalog under these names: Sodium 2-nitro-1,3-dioxopropan-2-ide hydrate, 95%, (2-Nitro-1,3-dioxopropan-2-yl)sodium hydrate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 100mg.
Sodium;2-nitropropanedial;hydrate (CAS 1260761-31-6) is a chemical compound with the molecular formula C3H4NNaO5 and a molecular weight of 157.06 g/mol. IUPAC name: sodium;2-nitropropanedial;hydrate. InChIKey: DQQCQHYLSWEYSN-UHFFFAOYSA-N.
| Molecular formula | C3H4NNaO5 |
|---|---|
| Molecular weight | 157.06 g/mol |
| IUPAC name | sodium;2-nitropropanedial;hydrate |
| InChIKey | DQQCQHYLSWEYSN-UHFFFAOYSA-N |
| SMILES | C(=O)[C-](C=O)[N+](=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)