CAS 53821-72-0 appears in our catalog under these names: Sodium nitromalonaldehyde monohydrate, 95%, Sodium 2–nitro–1,3–dioxopropan–2–ide hydrate, Sodium 2-nitro-1,3-dioxopropan-2-ide hydrate 97%, Sodium nitromalonaldehyde monohydrate, 97%, 97%, sodium N-oxido-1,3-dioxopropanimine oxide hydrate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
Sodium;(E)-2-nitro-3-oxoprop-1-en-1-olate;hydrate (CAS 53821-72-0) is a chemical compound with the molecular formula C3H4NNaO5 and a molecular weight of 157.06 g/mol. IUPAC name: sodium;(E)-2-nitro-3-oxoprop-1-en-1-olate;hydrate. InChIKey: MCCIGIZBACKHDO-BFAXJPPBSA-M.
| Molecular formula | C3H4NNaO5 |
|---|---|
| Molecular weight | 157.06 g/mol |
| IUPAC name | sodium;(E)-2-nitro-3-oxoprop-1-en-1-olate;hydrate |
| InChIKey | MCCIGIZBACKHDO-BFAXJPPBSA-M |
| SMILES | C(=C(\C=O)/[N+](=O)[O-])\[O-].O.[Na+] |
Computed by PubChem (NCBI)