CAS 1260763-85-6 appears in our catalog under these names: 5-Bromo-1h-imidazo[4,5-b]pyrazin-2(3h)-one, 95%, 5-Bromo-1H-imidazo(4,5-b)pyrazin-2(3H)-one, 97%, 5–Bromo–1H–imidazo(4,5–b)pyrazin–2(3H)–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
5-bromo-1,3-dihydroimidazo[4,5-b]pyrazin-2-one (CAS 1260763-85-6) is a chemical compound with the molecular formula C5H3BrN4O and a molecular weight of 215.01 g/mol. IUPAC name: 5-bromo-1,3-dihydroimidazo[4,5-b]pyrazin-2-one. InChIKey: KNHWRTKKDFEAEB-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN4O |
|---|---|
| Molecular weight | 215.01 g/mol |
| IUPAC name | 5-bromo-1,3-dihydroimidazo[4,5-b]pyrazin-2-one |
| InChIKey | KNHWRTKKDFEAEB-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=N1)NC(=O)N2)Br |
Computed by PubChem (NCBI)