Products 87781-93-9
CAS 87781-93-9 is the registry number for 2-Bromohypoxanthine, 96%. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g, 250mg.
2-bromo-1,7-dihydropurin-6-one (CAS 87781-93-9) is a chemical compound with the molecular formula C5H3BrN4O and a molecular weight of 215.01 g/mol. IUPAC name: 2-bromo-1,7-dihydropurin-6-one. InChIKey: ONXCBJOMYNPZNI-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN4O |
|---|---|
| Molecular weight | 215.01 g/mol |
| IUPAC name | 2-bromo-1,7-dihydropurin-6-one |
| InChIKey | ONXCBJOMYNPZNI-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=O)NC(=N2)Br |
Computed by PubChem (NCBI)
Synonyms:
2-Bromohypoxanthine, 2-bromo-6,7-dihydro-1H-purin-6-one, 2-Bromo-1H-purin-6(7H)-one, 2-bromo-1,7-dihydropurin-6-one, 2-bromo-3,7-dihydropurin-6-one, 2-bromo-1,9-dihydro-6H-purin-6-one, 2-Bromo-1,7-dihydro-6H-purin-6-one, Bromhypoxanthin, 2-Bromo-1,9-dihydro-purin-6-one, 2-bromohydropurin-6-one