CAS 1260780-77-5 is the registry number for (1-(4-Nitro-2-(trifluoromethyl)phenyl)piperidin-4-yl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
[1-[4-nitro-2-(trifluoromethyl)phenyl]piperidin-4-yl]methanol (CAS 1260780-77-5) is a chemical compound with the molecular formula C13H15F3N2O3 and a molecular weight of 304.26 g/mol. IUPAC name: [1-[4-nitro-2-(trifluoromethyl)phenyl]piperidin-4-yl]methanol. InChIKey: DIQPKHHZALRRSC-UHFFFAOYSA-N.
| Molecular formula | C13H15F3N2O3 |
|---|---|
| Molecular weight | 304.26 g/mol |
| IUPAC name | [1-[4-nitro-2-(trifluoromethyl)phenyl]piperidin-4-yl]methanol |
| InChIKey | DIQPKHHZALRRSC-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CO)C2=C(C=C(C=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)