Products 405910-36-3
CAS 405910-36-3 appears in our catalog under these names: 2,6-Dimethyl-4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine, 95%, 2,6-Dimethyl-4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 25g.
2,6-dimethyl-4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine (CAS 405910-36-3) is a chemical compound with the molecular formula C13H15F3N2O3 and a molecular weight of 304.26 g/mol. IUPAC name: 2,6-dimethyl-4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine. InChIKey: BIASKZQAUHXFGJ-UHFFFAOYSA-N.
| Molecular formula | C13H15F3N2O3 |
|---|---|
| Molecular weight | 304.26 g/mol |
| IUPAC name | 2,6-dimethyl-4-[2-nitro-4-(trifluoromethyl)phenyl]morpholine |
| InChIKey | BIASKZQAUHXFGJ-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)