Products 1260861-94-6

CAS 1260861-94-6 is the registry number for Ethyl 5-bromo-2-methyloxazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 5-bromo-2-methyl-1,3-oxazole-4-carboxylate (CAS 1260861-94-6) is a chemical compound with the molecular formula C7H8BrNO3 and a molecular weight of 234.05 g/mol. IUPAC name: ethyl 5-bromo-2-methyl-1,3-oxazole-4-carboxylate. InChIKey: WUYVDXANJRQDOO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BrNO3
Molecular weight234.05 g/mol
IUPAC nameethyl 5-bromo-2-methyl-1,3-oxazole-4-carboxylate
InChIKeyWUYVDXANJRQDOO-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(OC(=N1)C)Br

Computed by PubChem (NCBI)