CAS 682803-05-0 appears in our catalog under these names: 3-Amino-3-(5-bromo-2-furyl)propanoic acid, 95%, 3-Amino-3-(5-bromofuran-2-yl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-amino-3-(5-bromofuran-2-yl)propanoic acid (CAS 682803-05-0) is a chemical compound with the molecular formula C7H8BrNO3 and a molecular weight of 234.05 g/mol. IUPAC name: 3-amino-3-(5-bromofuran-2-yl)propanoic acid. InChIKey: GHSGHNSPJVMADK-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO3 |
|---|---|
| Molecular weight | 234.05 g/mol |
| IUPAC name | 3-amino-3-(5-bromofuran-2-yl)propanoic acid |
| InChIKey | GHSGHNSPJVMADK-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)C(CC(=O)O)N |
Computed by PubChem (NCBI)