CAS 1260878-79-2 is the registry number for 2-(2,5-Bis(trifluoromethyl)phenyl)acetaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2,5-bis(trifluoromethyl)phenyl]acetaldehyde (CAS 1260878-79-2) is a chemical compound with the molecular formula C10H6F6O and a molecular weight of 256.14 g/mol. IUPAC name: 2-[2,5-bis(trifluoromethyl)phenyl]acetaldehyde. InChIKey: VGZYUKBKRUURQG-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 2-[2,5-bis(trifluoromethyl)phenyl]acetaldehyde |
| InChIKey | VGZYUKBKRUURQG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CC=O)C(F)(F)F |
Computed by PubChem (NCBI)