Products 1881293-78-2
CAS 1881293-78-2 is the registry number for 2,2,2-Trifluoro-1-(3-methyl-4-(trifluoromethyl)phenyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2,2,2-trifluoro-1-[3-methyl-4-(trifluoromethyl)phenyl]ethanone (CAS 1881293-78-2) is a chemical compound with the molecular formula C10H6F6O and a molecular weight of 256.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-[3-methyl-4-(trifluoromethyl)phenyl]ethanone. InChIKey: YCDWOACIHOWMCW-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[3-methyl-4-(trifluoromethyl)phenyl]ethanone |
| InChIKey | YCDWOACIHOWMCW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)